C49H60N2O9 — CID 12983261
1-O-[(2R,4R)-2,4-bis[(2-methylpropan-2-yl)oxycarbonylamino]-1,5-diphenylpentan-3-yl] 5-O-prop-2-enyl (2R,4R)-2,4-dibenzyl-3-hydroxypentanedioate (PubChem CID 12983261) has the molecular formula C49H60N2O9 and a molecular weight of 821.02 g/mol. Its IUPAC name is 1-O-[(2R,4R)-2,4-bis[(2-methylpropan-2-yl)oxycarbonylamino]-1,5-diphenylpentan-3-yl] 5-O-prop-2-enyl (2R,4R)-2,4-dibenzyl-3-hydroxypentanedioate.
| Compound Name | 1-O-[(2R,4R)-2,4-bis[(2-methylpropan-2-yl)oxycarbonylamino]-1,5-diphenylpentan-3-yl] 5-O-prop-2-enyl (2R,4R)-2,4-dibenzyl-3-hydroxypentanedioate |
|---|---|
| PubChem CID | 12983261 |
| Molecular Formula | C49H60N2O9 |
| Molecular Weight | 821.02 g/mol |
| Exact Mass | 820.43 |
| IUPAC Name | 1-O-[(2R,4R)-2,4-bis[(2-methylpropan-2-yl)oxycarbonylamino]-1,5-diphenylpentan-3-yl] 5-O-prop-2-enyl (2R,4R)-2,4-dibenzyl-3-hydroxypentanedioate |
| SMILES | C=CCOC(=O)[C@H](Cc1ccccc1)C(O)[C@@H](Cc1ccccc1)C(=O)OC([C@@H](Cc1ccccc1)NC(=O)OC(C)(C)C)[C@@H](Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C49H60N2O9/c1-8-29-57-44(53)38(30-34-21-13-9-14-22-34)42(52)39(31-35-23-15-10-16-24-35)45(54)58-43(40(32-36-25-17-11-18-26-36)50-46(55)59-48(2,3)4)41(33-37-27-19-12-20-28-37)51-47(56)60-49(5,6)7/h8-28,38-43,52H,1,29-33H2,2-7H3,(H,50,55)(H,51,56)/t38-,39-,40-,41-,42?/m1/s1 |
| InChIKey | OULHHLPVFJAPEY-YXDKMXQPSA-N |
| XLogP | 7.98 |
| TPSA | 149.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.02 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|