C28H37Cl3FNO2Si — CID 53360567
N-[(Z,4S,7R)-8-[tert-butyl(diphenyl)silyl]oxy-5-fluoro-2,7-dimethyloct-5-en-4-yl]-2,2,2-trichloroacetamide (PubChem CID 53360567) has the molecular formula C28H37Cl3FNO2Si and a molecular weight of 573.05 g/mol. Its IUPAC name is N-[(Z,4S,7R)-8-[tert-butyl(diphenyl)silyl]oxy-5-fluoro-2,7-dimethyloct-5-en-4-yl]-2,2,2-trichloroacetamide.
| Compound Name | N-[(Z,4S,7R)-8-[tert-butyl(diphenyl)silyl]oxy-5-fluoro-2,7-dimethyloct-5-en-4-yl]-2,2,2-trichloroacetamide |
|---|---|
| PubChem CID | 53360567 |
| Molecular Formula | C28H37Cl3FNO2Si |
| Molecular Weight | 573.05 g/mol |
| Exact Mass | 571.16 |
| IUPAC Name | N-[(Z,4S,7R)-8-[tert-butyl(diphenyl)silyl]oxy-5-fluoro-2,7-dimethyloct-5-en-4-yl]-2,2,2-trichloroacetamide |
| SMILES | CC(C)C[C@H](NC(=O)C(Cl)(Cl)Cl)/C(F)=C/[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H37Cl3FNO2Si/c1-20(2)17-25(33-26(34)28(29,30)31)24(32)18-21(3)19-35-36(27(4,5)6,22-13-9-7-10-14-22)23-15-11-8-12-16-23/h7-16,18,20-21,25H,17,19H2,1-6H3,(H,33,34)/b24-18-/t21-,25+/m1/s1 |
| InChIKey | GEADCBGCALIJPW-VCBBELCASA-N |
| XLogP | 6.95 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.05 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|