C33H46N2O8Si — CID 10627755
1-[(2R,3S,4S,5R)-4-[(2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropyl]-3-hydroxy-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 10627755) has the molecular formula C33H46N2O8Si and a molecular weight of 626.82 g/mol. Its IUPAC name is 1-[(2R,3S,4S,5R)-4-[(2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropyl]-3-hydroxy-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3S,4S,5R)-4-[(2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropyl]-3-hydroxy-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10627755 |
| Molecular Formula | C33H46N2O8Si |
| Molecular Weight | 626.82 g/mol |
| Exact Mass | 626.30 |
| IUPAC Name | 1-[(2R,3S,4S,5R)-4-[(2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropyl]-3-hydroxy-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@@H]2O[C@H](COCc3ccccc3)[C@@](C[C@@H](O)CO[Si](C)(C)C(C)(C)C)(OCc3ccccc3)[C@@H]2O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C33H46N2O8Si/c1-23-18-35(31(39)34-29(23)38)30-28(37)33(41-20-25-15-11-8-12-16-25,17-26(36)21-42-44(5,6)32(2,3)4)27(43-30)22-40-19-24-13-9-7-10-14-24/h7-16,18,26-28,30,36-37H,17,19-22H2,1-6H3,(H,34,38,39)/t26-,27-,28-,30-,33-/m1/s1 |
| InChIKey | TUGVIMNQRQYBSR-GAGSTBKVSA-N |
| XLogP | 4.05 |
| TPSA | 132.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.82 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|