C29H32N2O8 — CID 10578272
[(2S,3aR,4R,6R,6aS)-6-(5-methyl-2,4-dioxopyrimidin-1-yl)-3a-phenylmethoxy-4-(phenylmethoxymethyl)-3,4,6,6a-tetrahydro-2H-furo[2,3-c]furan-2-yl]methyl acetate (PubChem CID 10578272) has the molecular formula C29H32N2O8 and a molecular weight of 536.58 g/mol. Its IUPAC name is [(2S,3aR,4R,6R,6aS)-6-(5-methyl-2,4-dioxopyrimidin-1-yl)-3a-phenylmethoxy-4-(phenylmethoxymethyl)-3,4,6,6a-tetrahydro-2H-furo[2,3-c]furan-2-yl]methyl acetate.
| Compound Name | [(2S,3aR,4R,6R,6aS)-6-(5-methyl-2,4-dioxopyrimidin-1-yl)-3a-phenylmethoxy-4-(phenylmethoxymethyl)-3,4,6,6a-tetrahydro-2H-furo[2,3-c]furan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10578272 |
| Molecular Formula | C29H32N2O8 |
| Molecular Weight | 536.58 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | [(2S,3aR,4R,6R,6aS)-6-(5-methyl-2,4-dioxopyrimidin-1-yl)-3a-phenylmethoxy-4-(phenylmethoxymethyl)-3,4,6,6a-tetrahydro-2H-furo[2,3-c]furan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1C[C@]2(OCc3ccccc3)[C@H](O1)[C@H](n1cc(C)c(=O)[nH]c1=O)O[C@@H]2COCc1ccccc1 |
| InChI | InChI=1S/C29H32N2O8/c1-19-14-31(28(34)30-26(19)33)27-25-29(13-23(38-25)17-36-20(2)32,37-16-22-11-7-4-8-12-22)24(39-27)18-35-15-21-9-5-3-6-10-21/h3-12,14,23-25,27H,13,15-18H2,1-2H3,(H,30,33,34)/t23-,24+,25+,27+,29+/m0/s1 |
| InChIKey | WHDKRWQCMKFZRF-WTUVVQGKSA-N |
| XLogP | 2.64 |
| TPSA | 118.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.58 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |