C34H38N2O9S — CID 10722914
3-[(2R,3S,4S,5R)-4-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-phenylmethoxy-2-(phenylmethoxymethyl)oxolan-3-yl]propyl 4-methylbenzenesulfonate (PubChem CID 10722914) has the molecular formula C34H38N2O9S and a molecular weight of 650.75 g/mol. Its IUPAC name is 3-[(2R,3S,4S,5R)-4-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-phenylmethoxy-2-(phenylmethoxymethyl)oxolan-3-yl]propyl 4-methylbenzenesulfonate.
| Compound Name | 3-[(2R,3S,4S,5R)-4-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-phenylmethoxy-2-(phenylmethoxymethyl)oxolan-3-yl]propyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10722914 |
| Molecular Formula | C34H38N2O9S |
| Molecular Weight | 650.75 g/mol |
| Exact Mass | 650.23 |
| IUPAC Name | 3-[(2R,3S,4S,5R)-4-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-phenylmethoxy-2-(phenylmethoxymethyl)oxolan-3-yl]propyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCC[C@]2(OCc3ccccc3)[C@H](O)[C@H](n3cc(C)c(=O)[nH]c3=O)O[C@@H]2COCc2ccccc2)cc1 |
| InChI | InChI=1S/C34H38N2O9S/c1-24-14-16-28(17-15-24)46(40,41)44-19-9-18-34(43-22-27-12-7-4-8-13-27)29(23-42-21-26-10-5-3-6-11-26)45-32(30(34)37)36-20-25(2)31(38)35-33(36)39/h3-8,10-17,20,29-30,32,37H,9,18-19,21-23H2,1-2H3,(H,35,38,39)/t29-,30-,32-,34-/m1/s1 |
| InChIKey | HAXAVFYRQFRQPO-JIWQRGMRSA-N |
| XLogP | 3.77 |
| TPSA | 146.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.75 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|