C20H24N2O8S — CID 42639515
[(1R,3R,4R,5S,6S,7S)-7-hydroxy-1-(hydroxymethyl)-5-methyl-3-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-oxabicyclo[2.2.1]heptan-6-yl] 4-methylbenzenesulfonate (PubChem CID 42639515) has the molecular formula C20H24N2O8S and a molecular weight of 452.49 g/mol. Its IUPAC name is [(1R,3R,4R,5S,6S,7S)-7-hydroxy-1-(hydroxymethyl)-5-methyl-3-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-oxabicyclo[2.2.1]heptan-6-yl] 4-methylbenzenesulfonate.
| Compound Name | [(1R,3R,4R,5S,6S,7S)-7-hydroxy-1-(hydroxymethyl)-5-methyl-3-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-oxabicyclo[2.2.1]heptan-6-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 42639515 |
| Molecular Formula | C20H24N2O8S |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | [(1R,3R,4R,5S,6S,7S)-7-hydroxy-1-(hydroxymethyl)-5-methyl-3-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-oxabicyclo[2.2.1]heptan-6-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2[C@@H](C)[C@H]3[C@H](n4cc(C)c(=O)[nH]c4=O)O[C@]2(CO)[C@H]3O)cc1 |
| InChI | InChI=1S/C20H24N2O8S/c1-10-4-6-13(7-5-10)31(27,28)30-16-12(3)14-15(24)20(16,9-23)29-18(14)22-8-11(2)17(25)21-19(22)26/h4-8,12,14-16,18,23-24H,9H2,1-3H3,(H,21,25,26)/t12-,14+,15-,16-,18+,20+/m0/s1 |
| InChIKey | AVZDBZBWUBFBHL-SALDPYINSA-N |
| XLogP | -0.19 |
| TPSA | 147.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|