C16H18N2O8S — CID 11918408
[(2S,3R,4R,5S)-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] 4-methylbenzenesulfonate (PubChem CID 11918408) has the molecular formula C16H18N2O8S and a molecular weight of 398.39 g/mol. Its IUPAC name is [(2S,3R,4R,5S)-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [(2S,3R,4R,5S)-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11918408 |
| Molecular Formula | C16H18N2O8S |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | [(2S,3R,4R,5S)-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H]2[C@H](O)[C@H](CO)O[C@@H]2n2ccc(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C16H18N2O8S/c1-9-2-4-10(5-3-9)27(23,24)26-14-13(21)11(8-19)25-15(14)18-7-6-12(20)17-16(18)22/h2-7,11,13-15,19,21H,8H2,1H3,(H,17,20,22)/t11-,13+,14+,15-/m0/s1 |
| InChIKey | PELFVTNUPTXPNF-MYPMTAMASA-N |
| XLogP | -1.13 |
| TPSA | 147.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|