C30H40N2O12S — CID 54578822
[(2S,3R,4R,5R)-3,4-di(butanoyloxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-[(4-methylphenyl)sulfonyloxymethyl]oxolan-2-yl]methyl butanoate (PubChem CID 54578822) has the molecular formula C30H40N2O12S and a molecular weight of 652.72 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-3,4-di(butanoyloxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-[(4-methylphenyl)sulfonyloxymethyl]oxolan-2-yl]methyl butanoate.
| Compound Name | [(2S,3R,4R,5R)-3,4-di(butanoyloxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-[(4-methylphenyl)sulfonyloxymethyl]oxolan-2-yl]methyl butanoate |
|---|---|
| PubChem CID | 54578822 |
| Molecular Formula | C30H40N2O12S |
| Molecular Weight | 652.72 g/mol |
| Exact Mass | 652.23 |
| IUPAC Name | [(2S,3R,4R,5R)-3,4-di(butanoyloxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-[(4-methylphenyl)sulfonyloxymethyl]oxolan-2-yl]methyl butanoate |
| SMILES | CCCC(=O)OC[C@@]1(COS(=O)(=O)c2ccc(C)cc2)O[C@@H](n2cc(C)c(=O)[nH]c2=O)[C@H](OC(=O)CCC)[C@H]1OC(=O)CCC |
| InChI | InChI=1S/C30H40N2O12S/c1-6-9-22(33)40-17-30(18-41-45(38,39)21-14-12-19(4)13-15-21)26(43-24(35)11-8-3)25(42-23(34)10-7-2)28(44-30)32-16-20(5)27(36)31-29(32)37/h12-16,25-26,28H,6-11,17-18H2,1-5H3,(H,31,36,37)/t25-,26-,28-,30+/m1/s1 |
| InChIKey | YZKVHJQFZRUMQP-RCOPJXKKSA-N |
| XLogP | 2.59 |
| TPSA | 186.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.72 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|