C22H27ClN2O8S — CID 10864192
[(2R,3R,4R,5R)-4-chloro-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-(4-methylphenyl)sulfonyloxyoxolan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 10864192) has the molecular formula C22H27ClN2O8S and a molecular weight of 514.98 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-4-chloro-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-(4-methylphenyl)sulfonyloxyoxolan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3R,4R,5R)-4-chloro-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-(4-methylphenyl)sulfonyloxyoxolan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10864192 |
| Molecular Formula | C22H27ClN2O8S |
| Molecular Weight | 514.98 g/mol |
| Exact Mass | 514.12 |
| IUPAC Name | [(2R,3R,4R,5R)-4-chloro-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-(4-methylphenyl)sulfonyloxyoxolan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2[C@@H](Cl)[C@H](n3cc(C)c(=O)[nH]c3=O)O[C@@H]2COC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H27ClN2O8S/c1-12-6-8-14(9-7-12)34(29,30)33-17-15(11-31-20(27)22(3,4)5)32-19(16(17)23)25-10-13(2)18(26)24-21(25)28/h6-10,15-17,19H,11H2,1-5H3,(H,24,26,28)/t15-,16-,17-,19-/m1/s1 |
| InChIKey | ABCRGJSPUUYNTG-YWTNHNAXSA-N |
| XLogP | 2.02 |
| TPSA | 133.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.98 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|