C29H39N2O8P — CID 10650787
1-[[(2S,3R)-5-diethoxyphosphoryl-1,2-bis(phenylmethoxy)pentan-3-yl]oxymethyl]-5-methylpyrimidine-2,4-dione (PubChem CID 10650787) has the molecular formula C29H39N2O8P and a molecular weight of 574.61 g/mol. Its IUPAC name is 1-[[(2S,3R)-5-diethoxyphosphoryl-1,2-bis(phenylmethoxy)pentan-3-yl]oxymethyl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[[(2S,3R)-5-diethoxyphosphoryl-1,2-bis(phenylmethoxy)pentan-3-yl]oxymethyl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10650787 |
| Molecular Formula | C29H39N2O8P |
| Molecular Weight | 574.61 g/mol |
| Exact Mass | 574.24 |
| IUPAC Name | 1-[[(2S,3R)-5-diethoxyphosphoryl-1,2-bis(phenylmethoxy)pentan-3-yl]oxymethyl]-5-methylpyrimidine-2,4-dione |
| SMILES | CCOP(=O)(CC[C@@H](OCn1cc(C)c(=O)[nH]c1=O)[C@H](COCc1ccccc1)OCc1ccccc1)OCC |
| InChI | InChI=1S/C29H39N2O8P/c1-4-38-40(34,39-5-2)17-16-26(37-22-31-18-23(3)28(32)30-29(31)33)27(36-20-25-14-10-7-11-15-25)21-35-19-24-12-8-6-9-13-24/h6-15,18,26-27H,4-5,16-17,19-22H2,1-3H3,(H,30,32,33)/t26-,27+/m1/s1 |
| InChIKey | VFAGSQDYCAZRCH-SXOMAYOGSA-N |
| XLogP | 4.65 |
| TPSA | 118.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.61 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|