C47H62N3O8PSi2 — CID 102436522
N-[1,3-bis[[tert-butyl(diphenyl)silyl]oxy]propan-2-yl]-N-(diethoxyphosphorylmethyl)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetamide (PubChem CID 102436522) has the molecular formula C47H62N3O8PSi2 and a molecular weight of 884.17 g/mol. Its IUPAC name is N-[1,3-bis[[tert-butyl(diphenyl)silyl]oxy]propan-2-yl]-N-(diethoxyphosphorylmethyl)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetamide.
| Compound Name | N-[1,3-bis[[tert-butyl(diphenyl)silyl]oxy]propan-2-yl]-N-(diethoxyphosphorylmethyl)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetamide |
|---|---|
| PubChem CID | 102436522 |
| Molecular Formula | C47H62N3O8PSi2 |
| Molecular Weight | 884.17 g/mol |
| Exact Mass | 883.38 |
| IUPAC Name | N-[1,3-bis[[tert-butyl(diphenyl)silyl]oxy]propan-2-yl]-N-(diethoxyphosphorylmethyl)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetamide |
| SMILES | CCOP(=O)(CN(C(=O)Cn1cc(C)c(=O)[nH]c1=O)C(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OCC |
| InChI | InChI=1S/C47H62N3O8PSi2/c1-10-55-59(54,56-11-2)36-50(43(51)33-49-32-37(3)44(52)48-45(49)53)38(34-57-60(46(4,5)6,39-24-16-12-17-25-39)40-26-18-13-19-27-40)35-58-61(47(7,8)9,41-28-20-14-21-29-41)42-30-22-15-23-31-42/h12-32,38H,10-11,33-36H2,1-9H3,(H,48,52,53) |
| InChIKey | YLKJKGLWZZHXLF-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 129.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 884.17 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|