C14H24N3O7P — CID 137346213
N-(3-diethoxyphosphoryl-3-hydroxypropyl)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetamide (PubChem CID 137346213) has the molecular formula C14H24N3O7P and a molecular weight of 377.33 g/mol. Its IUPAC name is N-(3-diethoxyphosphoryl-3-hydroxypropyl)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetamide.
| Compound Name | N-(3-diethoxyphosphoryl-3-hydroxypropyl)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetamide |
|---|---|
| PubChem CID | 137346213 |
| Molecular Formula | C14H24N3O7P |
| Molecular Weight | 377.33 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | N-(3-diethoxyphosphoryl-3-hydroxypropyl)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetamide |
| SMILES | CCOP(=O)(OCC)C(O)CCNC(=O)Cn1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H24N3O7P/c1-4-23-25(22,24-5-2)12(19)6-7-15-11(18)9-17-8-10(3)13(20)16-14(17)21/h8,12,19H,4-7,9H2,1-3H3,(H,15,18)(H,16,20,21) |
| InChIKey | YXLULGUAAPLUPN-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 139.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.33 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|