C17H27N2O5P — CID 11337676
1-(4-diethoxyphosphoryl-2-methylhepta-2,3-dienyl)-5-methylpyrimidine-2,4-dione (PubChem CID 11337676) has the molecular formula C17H27N2O5P and a molecular weight of 370.39 g/mol. Its IUPAC name is 1-(4-diethoxyphosphoryl-2-methylhepta-2,3-dienyl)-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-(4-diethoxyphosphoryl-2-methylhepta-2,3-dienyl)-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11337676 |
| Molecular Formula | C17H27N2O5P |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 1-(4-diethoxyphosphoryl-2-methylhepta-2,3-dienyl)-5-methylpyrimidine-2,4-dione |
| SMILES | CCCC(=C=C(C)Cn1cc(C)c(=O)[nH]c1=O)P(=O)(OCC)OCC |
| InChI | InChI=1S/C17H27N2O5P/c1-6-9-15(25(22,23-7-2)24-8-3)10-13(4)11-19-12-14(5)16(20)18-17(19)21/h12H,6-9,11H2,1-5H3,(H,18,20,21) |
| InChIKey | YRQFTGQBZMICAL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|