C11H17N2O5P — CID 5470771
1-[(E)-2-diethoxyphosphorylethenyl]-5-methylpyrimidine-2,4-dione (PubChem CID 5470771) has the molecular formula C11H17N2O5P and a molecular weight of 288.24 g/mol. Its IUPAC name is 1-[(E)-2-diethoxyphosphorylethenyl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(E)-2-diethoxyphosphorylethenyl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 5470771 |
| Molecular Formula | C11H17N2O5P |
| Molecular Weight | 288.24 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 1-[(E)-2-diethoxyphosphorylethenyl]-5-methylpyrimidine-2,4-dione |
| SMILES | CCOP(=O)(/C=C/n1cc(C)c(=O)[nH]c1=O)OCC |
| InChI | InChI=1S/C11H17N2O5P/c1-4-17-19(16,18-5-2)7-6-13-8-9(3)10(14)12-11(13)15/h6-8H,4-5H2,1-3H3,(H,12,14,15)/b7-6+ |
| InChIKey | UXLGYEMCEQNJGM-VOTSOKGWSA-N |
| XLogP | 1.54 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.24 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|