C11H17N2O3P — CID 91234454
1-[(Z)-4-dimethylphosphorylbut-1-enyl]-5-methylpyrimidine-2,4-dione (PubChem CID 91234454) has the molecular formula C11H17N2O3P and a molecular weight of 256.24 g/mol. Its IUPAC name is 1-[(Z)-4-dimethylphosphorylbut-1-enyl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(Z)-4-dimethylphosphorylbut-1-enyl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 91234454 |
| Molecular Formula | C11H17N2O3P |
| Molecular Weight | 256.24 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 1-[(Z)-4-dimethylphosphorylbut-1-enyl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn(/C=C\CCP(C)(C)=O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H17N2O3P/c1-9-8-13(11(15)12-10(9)14)6-4-5-7-17(2,3)16/h4,6,8H,5,7H2,1-3H3,(H,12,14,15)/b6-4- |
| InChIKey | AKOAWLFTUUQPAJ-XQRVVYSFSA-N |
| XLogP | 1.33 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.24 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|