C8H15N4O2+ — CID 20676015
amino-dimethyl-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]azanium (PubChem CID 20676015) has the molecular formula C8H15N4O2+ and a molecular weight of 199.23 g/mol. Its IUPAC name is amino-dimethyl-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]azanium.
| Compound Name | amino-dimethyl-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]azanium |
|---|---|
| PubChem CID | 20676015 |
| Molecular Formula | C8H15N4O2+ |
| Molecular Weight | 199.23 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | amino-dimethyl-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]azanium |
| SMILES | Cc1cn(C[N+](C)(C)N)c(=O)[nH]c1=O |
| InChI | InChI=1S/C8H14N4O2/c1-6-4-11(5-12(2,3)9)8(14)10-7(6)13/h4H,5,9H2,1-3H3/p+1 |
| InChIKey | GUQMOMDRNOLAFU-UHFFFAOYSA-O |
| XLogP | -1.25 |
| TPSA | 80.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.23 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|