C9H12N2O3 — CID 71327942
1-(2-ethenoxyethyl)-5-methylpyrimidine-2,4-dione (PubChem CID 71327942) has the molecular formula C9H12N2O3 and a molecular weight of 196.21 g/mol. Its IUPAC name is 1-(2-ethenoxyethyl)-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-(2-ethenoxyethyl)-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 71327942 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 1-(2-ethenoxyethyl)-5-methylpyrimidine-2,4-dione |
| SMILES | C=COCCn1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H12N2O3/c1-3-14-5-4-11-6-7(2)8(12)10-9(11)13/h3,6H,1,4-5H2,2H3,(H,10,12,13) |
| InChIKey | PZQYOZUSYXXHBY-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|