C12H19N2O6P — CID 46231729
[1-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethoxy]cyclopentyl]phosphonic acid (PubChem CID 46231729) has the molecular formula C12H19N2O6P and a molecular weight of 318.27 g/mol. Its IUPAC name is [1-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethoxy]cyclopentyl]phosphonic acid.
| Compound Name | [1-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethoxy]cyclopentyl]phosphonic acid |
|---|---|
| PubChem CID | 46231729 |
| Molecular Formula | C12H19N2O6P |
| Molecular Weight | 318.27 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | [1-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethoxy]cyclopentyl]phosphonic acid |
| SMILES | Cc1cn(CCOC2(P(=O)(O)O)CCCC2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H19N2O6P/c1-9-8-14(11(16)13-10(9)15)6-7-20-12(21(17,18)19)4-2-3-5-12/h8H,2-7H2,1H3,(H,13,15,16)(H2,17,18,19) |
| InChIKey | ADHNZEZJZJEWQG-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 121.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.27 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|