C13H21N2O6P — CID 46231728
[1-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethoxy]cyclohexyl]phosphonic acid (PubChem CID 46231728) has the molecular formula C13H21N2O6P and a molecular weight of 332.29 g/mol. Its IUPAC name is [1-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethoxy]cyclohexyl]phosphonic acid.
| Compound Name | [1-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethoxy]cyclohexyl]phosphonic acid |
|---|---|
| PubChem CID | 46231728 |
| Molecular Formula | C13H21N2O6P |
| Molecular Weight | 332.29 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | [1-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethoxy]cyclohexyl]phosphonic acid |
| SMILES | Cc1cn(CCOC2(P(=O)(O)O)CCCCC2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H21N2O6P/c1-10-9-15(12(17)14-11(10)16)7-8-21-13(22(18,19)20)5-3-2-4-6-13/h9H,2-8H2,1H3,(H,14,16,17)(H2,18,19,20) |
| InChIKey | JYZKRWZPTQCXOH-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 121.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.29 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|