C9H14N3O5P — CID 501412
[2-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]aziridin-1-yl]methylphosphonic acid (PubChem CID 501412) has the molecular formula C9H14N3O5P and a molecular weight of 275.20 g/mol. Its IUPAC name is [2-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]aziridin-1-yl]methylphosphonic acid.
| Compound Name | [2-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]aziridin-1-yl]methylphosphonic acid |
|---|---|
| PubChem CID | 501412 |
| Molecular Formula | C9H14N3O5P |
| Molecular Weight | 275.20 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | [2-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]aziridin-1-yl]methylphosphonic acid |
| SMILES | Cc1cn(CC2CN2CP(=O)(O)O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H14N3O5P/c1-6-2-11(9(14)10-8(6)13)3-7-4-12(7)5-18(15,16)17/h2,7H,3-5H2,1H3,(H,10,13,14)(H2,15,16,17) |
| InChIKey | NLIXJDOCGOKVFR-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.20 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|