C13H17ClN2O3 — CID 158504531
1-[[(1S,2S,4S,7R)-2-chloro-5-hydroxy-7-bicyclo[2.2.1]heptanyl]methyl]-5-methylpyrimidine-2,4-dione (PubChem CID 158504531) has the molecular formula C13H17ClN2O3 and a molecular weight of 284.74 g/mol. Its IUPAC name is 1-[[(1S,2S,4S,7R)-2-chloro-5-hydroxy-7-bicyclo[2.2.1]heptanyl]methyl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[[(1S,2S,4S,7R)-2-chloro-5-hydroxy-7-bicyclo[2.2.1]heptanyl]methyl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 158504531 |
| Molecular Formula | C13H17ClN2O3 |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 1-[[(1S,2S,4S,7R)-2-chloro-5-hydroxy-7-bicyclo[2.2.1]heptanyl]methyl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn(C[C@H]2[C@@H]3CC(O)[C@H]2C[C@@H]3Cl)c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H17ClN2O3/c1-6-4-16(13(19)15-12(6)18)5-9-7-3-11(17)8(9)2-10(7)14/h4,7-11,17H,2-3,5H2,1H3,(H,15,18,19)/t7-,8-,9-,10-,11?/m0/s1 |
| InChIKey | HKHRKQQMCIKPCU-LJHPZOEFSA-N |
| XLogP | 0.47 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|