C11H20N2O10P2 — CID 23628543
[2-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]-3-(phosphonomethoxy)propoxy]methylphosphonic acid (PubChem CID 23628543) has the molecular formula C11H20N2O10P2 and a molecular weight of 402.23 g/mol. Its IUPAC name is [2-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]-3-(phosphonomethoxy)propoxy]methylphosphonic acid.
| Compound Name | [2-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]-3-(phosphonomethoxy)propoxy]methylphosphonic acid |
|---|---|
| PubChem CID | 23628543 |
| Molecular Formula | C11H20N2O10P2 |
| Molecular Weight | 402.23 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | [2-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]-3-(phosphonomethoxy)propoxy]methylphosphonic acid |
| SMILES | Cc1cn(CC(COCP(=O)(O)O)COCP(=O)(O)O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H20N2O10P2/c1-8-2-13(11(15)12-10(8)14)3-9(4-22-6-24(16,17)18)5-23-7-25(19,20)21/h2,9H,3-7H2,1H3,(H,12,14,15)(H2,16,17,18)(H2,19,20,21) |
| InChIKey | BJTLVNLRQWTCDQ-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 188.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.23 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|