C10H11N2O7P — CID 143334289
[5-(5-methyl-2,4-dioxopyrimidin-1-yl)furan-2-yl]oxymethylphosphonic acid (PubChem CID 143334289) has the molecular formula C10H11N2O7P and a molecular weight of 302.18 g/mol. Its IUPAC name is [5-(5-methyl-2,4-dioxopyrimidin-1-yl)furan-2-yl]oxymethylphosphonic acid.
| Compound Name | [5-(5-methyl-2,4-dioxopyrimidin-1-yl)furan-2-yl]oxymethylphosphonic acid |
|---|---|
| PubChem CID | 143334289 |
| Molecular Formula | C10H11N2O7P |
| Molecular Weight | 302.18 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | [5-(5-methyl-2,4-dioxopyrimidin-1-yl)furan-2-yl]oxymethylphosphonic acid |
| SMILES | Cc1cn(-c2ccc(OCP(=O)(O)O)o2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H11N2O7P/c1-6-4-12(10(14)11-9(6)13)7-2-3-8(19-7)18-5-20(15,16)17/h2-4H,5H2,1H3,(H,11,13,14)(H2,15,16,17) |
| InChIKey | HLMITVMFSORCKA-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 134.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.18 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|