C18H26N3O8P — CID 66936233
[(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl dihydrogen phosphate;2,3,4-trimethylpyridine (PubChem CID 66936233) has the molecular formula C18H26N3O8P and a molecular weight of 443.39 g/mol. Its IUPAC name is [(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl dihydrogen phosphate;2,3,4-trimethylpyridine.
| Compound Name | [(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl dihydrogen phosphate;2,3,4-trimethylpyridine |
|---|---|
| PubChem CID | 66936233 |
| Molecular Formula | C18H26N3O8P |
| Molecular Weight | 443.39 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | [(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl dihydrogen phosphate;2,3,4-trimethylpyridine |
| SMILES | Cc1ccnc(C)c1C.Cc1cn([C@H]2C[C@H](O)[C@@H](COP(=O)(O)O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H15N2O8P.C8H11N/c1-5-3-12(10(15)11-9(5)14)8-2-6(13)7(20-8)4-19-21(16,17)18;1-6-4-5-9-8(3)7(6)2/h3,6-8,13H,2,4H2,1H3,(H,11,14,15)(H2,16,17,18);4-5H,1-3H3/t6-,7+,8+;/m0./s1 |
| InChIKey | FZBAWDNFYICCPX-HNPMAXIBSA-N |
| XLogP | 0.61 |
| TPSA | 163.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.39 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|