C8H12FN2O6P — CID 56946660
[3-(2,4-dioxopyrimidin-1-yl)-2-fluoropropoxy]methylphosphonic acid (PubChem CID 56946660) has the molecular formula C8H12FN2O6P and a molecular weight of 282.16 g/mol. Its IUPAC name is [3-(2,4-dioxopyrimidin-1-yl)-2-fluoropropoxy]methylphosphonic acid.
| Compound Name | [3-(2,4-dioxopyrimidin-1-yl)-2-fluoropropoxy]methylphosphonic acid |
|---|---|
| PubChem CID | 56946660 |
| Molecular Formula | C8H12FN2O6P |
| Molecular Weight | 282.16 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | [3-(2,4-dioxopyrimidin-1-yl)-2-fluoropropoxy]methylphosphonic acid |
| SMILES | O=c1ccn(CC(F)COCP(=O)(O)O)c(=O)[nH]1 |
| InChI | InChI=1S/C8H12FN2O6P/c9-6(4-17-5-18(14,15)16)3-11-2-1-7(12)10-8(11)13/h1-2,6H,3-5H2,(H,10,12,13)(H2,14,15,16) |
| InChIKey | UHCZXVFKHMZTCD-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 121.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.16 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|