C8H12N3Na2O6P — CID 11500754
disodium;1-[2-hydroxy-3-(phosphonatomethylamino)propyl]pyrimidine-2,4-dione (PubChem CID 11500754) has the molecular formula C8H12N3Na2O6P and a molecular weight of 323.15 g/mol. Its IUPAC name is disodium;1-[2-hydroxy-3-(phosphonatomethylamino)propyl]pyrimidine-2,4-dione.
| Compound Name | disodium;1-[2-hydroxy-3-(phosphonatomethylamino)propyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11500754 |
| Molecular Formula | C8H12N3Na2O6P |
| Molecular Weight | 323.15 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | disodium;1-[2-hydroxy-3-(phosphonatomethylamino)propyl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn(CC(O)CNCP(=O)([O-])[O-])c(=O)[nH]1.[Na+].[Na+] |
| InChI | InChI=1S/C8H14N3O6P.2Na/c12-6(3-9-5-18(15,16)17)4-11-2-1-7(13)10-8(11)14;;/h1-2,6,9,12H,3-5H2,(H,10,13,14)(H2,15,16,17);;/q;2*+1/p-2 |
| InChIKey | LOMNNPGSZNIKCO-UHFFFAOYSA-L |
| XLogP | -9.63 |
| TPSA | 150.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.15 |
| LogP ≤ 5 | -9.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|