C9H13Li2N2O6P — CID 11659294
dilithium;5-methyl-1-[(2R)-2-(phosphonatomethoxy)propyl]pyrimidine-2,4-dione (PubChem CID 11659294) has the molecular formula C9H13Li2N2O6P and a molecular weight of 290.07 g/mol. Its IUPAC name is dilithium;5-methyl-1-[(2R)-2-(phosphonatomethoxy)propyl]pyrimidine-2,4-dione.
| Compound Name | dilithium;5-methyl-1-[(2R)-2-(phosphonatomethoxy)propyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11659294 |
| Molecular Formula | C9H13Li2N2O6P |
| Molecular Weight | 290.07 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | dilithium;5-methyl-1-[(2R)-2-(phosphonatomethoxy)propyl]pyrimidine-2,4-dione |
| SMILES | Cc1cn(C[C@@H](C)OCP(=O)([O-])[O-])c(=O)[nH]c1=O.[Li+].[Li+] |
| InChI | InChI=1S/C9H15N2O6P.2Li/c1-6-3-11(9(13)10-8(6)12)4-7(2)17-5-18(14,15)16;;/h3,7H,4-5H2,1-2H3,(H,10,12,13)(H2,14,15,16);;/q;2*+1/p-2/t7-;;/m1../s1 |
| InChIKey | CJSPSWDMTIJLNE-XCUBXKJBSA-L |
| XLogP | -7.87 |
| TPSA | 127.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.07 |
| LogP ≤ 5 | -7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|