C18H33N2O6P — CID 89386976
1-[(4S)-4-[di(propan-2-yloxy)phosphorylmethoxy]-2-methylpentyl]-5-methylpyrimidine-2,4-dione (PubChem CID 89386976) has the molecular formula C18H33N2O6P and a molecular weight of 404.44 g/mol. Its IUPAC name is 1-[(4S)-4-[di(propan-2-yloxy)phosphorylmethoxy]-2-methylpentyl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(4S)-4-[di(propan-2-yloxy)phosphorylmethoxy]-2-methylpentyl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 89386976 |
| Molecular Formula | C18H33N2O6P |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 1-[(4S)-4-[di(propan-2-yloxy)phosphorylmethoxy]-2-methylpentyl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn(CC(C)C[C@H](C)OCP(=O)(OC(C)C)OC(C)C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H33N2O6P/c1-12(2)25-27(23,26-13(3)4)11-24-16(7)8-14(5)9-20-10-15(6)17(21)19-18(20)22/h10,12-14,16H,8-9,11H2,1-7H3,(H,19,21,22)/t14?,16-/m0/s1 |
| InChIKey | YAOQOXQBBQXWQX-WMCAAGNKSA-N |
| XLogP | 3.28 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|