C16H26N2O2 — CID 102262411
5-methyl-1-undec-10-enylpyrimidine-2,4-dione (PubChem CID 102262411) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 5-methyl-1-undec-10-enylpyrimidine-2,4-dione.
| Compound Name | 5-methyl-1-undec-10-enylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 102262411 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 5-methyl-1-undec-10-enylpyrimidine-2,4-dione |
| SMILES | C=CCCCCCCCCCn1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H26N2O2/c1-3-4-5-6-7-8-9-10-11-12-18-13-14(2)15(19)17-16(18)20/h3,13H,1,4-12H2,2H3,(H,17,19,20) |
| InChIKey | XYXYHPCMUVOALT-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|