C9H12N2O4S — CID 71331319
1-(2-ethenylsulfonylethyl)-5-methylpyrimidine-2,4-dione (PubChem CID 71331319) has the molecular formula C9H12N2O4S and a molecular weight of 244.27 g/mol. Its IUPAC name is 1-(2-ethenylsulfonylethyl)-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-(2-ethenylsulfonylethyl)-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 71331319 |
| Molecular Formula | C9H12N2O4S |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 1-(2-ethenylsulfonylethyl)-5-methylpyrimidine-2,4-dione |
| SMILES | C=CS(=O)(=O)CCn1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H12N2O4S/c1-3-16(14,15)5-4-11-6-7(2)8(12)10-9(11)13/h3,6H,1,4-5H2,2H3,(H,10,12,13) |
| InChIKey | PFAYYYCAQPIFTR-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 89.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |