C18H22N4NaO10P — CID 23681372
sodium bis[(Z)-2-(hydroxymethyl)-3-(5-methyl-2,4-dioxopyrimidin-1-yl)prop-2-enyl] phosphate (PubChem CID 23681372) has the molecular formula C18H22N4NaO10P and a molecular weight of 508.36 g/mol. Its IUPAC name is sodium bis[(Z)-2-(hydroxymethyl)-3-(5-methyl-2,4-dioxopyrimidin-1-yl)prop-2-enyl] phosphate.
| Compound Name | sodium bis[(Z)-2-(hydroxymethyl)-3-(5-methyl-2,4-dioxopyrimidin-1-yl)prop-2-enyl] phosphate |
|---|---|
| PubChem CID | 23681372 |
| Molecular Formula | C18H22N4NaO10P |
| Molecular Weight | 508.36 g/mol |
| Exact Mass | 508.10 |
| IUPAC Name | sodium bis[(Z)-2-(hydroxymethyl)-3-(5-methyl-2,4-dioxopyrimidin-1-yl)prop-2-enyl] phosphate |
| SMILES | Cc1cn(/C=C(/CO)COP(=O)([O-])OC/C(=C\n2cc(C)c(=O)[nH]c2=O)CO)c(=O)[nH]c1=O.[Na+] |
| InChI | InChI=1S/C18H23N4O10P.Na/c1-11-3-21(17(27)19-15(11)25)5-13(7-23)9-31-33(29,30)32-10-14(8-24)6-22-4-12(2)16(26)20-18(22)28;/h3-6,23-24H,7-10H2,1-2H3,(H,29,30)(H,19,25,27)(H,20,26,28);/q;+1/p-1/b13-5-,14-6-; |
| InChIKey | PFSPAOHLKNGIIX-BYCWBGNYSA-M |
| XLogP | -5.12 |
| TPSA | 208.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.36 |
| LogP ≤ 5 | -5.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|