About sodium 5-methyl-2,4-dioxopyrimidine-1-carboxylate
sodium 5-methyl-2,4-dioxopyrimidine-1-carboxylate (PubChem CID 139627493) has the molecular formula C6H5N2NaO4
and a molecular weight of 192.11 g/mol. Its IUPAC name is sodium 5-methyl-2,4-dioxopyrimidine-1-carboxylate.
Molecular Properties
| Compound Name | sodium 5-methyl-2,4-dioxopyrimidine-1-carboxylate |
| PubChem CID | 139627493 |
| Molecular Formula | C6H5N2NaO4 |
| Molecular Weight | 192.11 g/mol |
| Exact Mass | 192.01 |
| IUPAC Name | sodium 5-methyl-2,4-dioxopyrimidine-1-carboxylate |
| SMILES | Cc1cn(C(=O)[O-])c(=O)[nH]c1=O.[Na+] |
| InChI | InChI=1S/C6H6N2O4.Na/c1-3-2-8(6(11)12)5(10)7-4(3)9;/h2H,1H3,(H,11,12)(H,7,9,10);/q;+1/p-1 |
| InChIKey | HHVQCDDYMLIHNY-UHFFFAOYSA-M |
| XLogP | -4.96 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.11 |
| LogP ≤ 5 | -4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze sodium 5-methyl-2,4-dioxopyrimidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 5-methyl-2,4-dioxopyrimidine-1-carboxylate?
The IUPAC name of sodium 5-methyl-2,4-dioxopyrimidine-1-carboxylate (CID 139627493) is sodium 5-methyl-2,4-dioxopyrimidine-1-carboxylate.
What is the SMILES notation for sodium 5-methyl-2,4-dioxopyrimidine-1-carboxylate?
The canonical SMILES for sodium 5-methyl-2,4-dioxopyrimidine-1-carboxylate is Cc1cn(C(=O)[O-])c(=O)[nH]c1=O.[Na+].
What is the InChIKey of sodium 5-methyl-2,4-dioxopyrimidine-1-carboxylate?
The InChIKey is HHVQCDDYMLIHNY-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H6N2O4.Na/c1-3-2-8(6(11)12)5(10)7-4(3)9;/h2H,1H3,(H,11,12)(H,7,9,10);/q;+1/p-1.
What are the key properties of sodium 5-methyl-2,4-dioxopyrimidine-1-carboxylate?
sodium 5-methyl-2,4-dioxopyrimidine-1-carboxylate has a molecular weight of 192.11 g/mol, XLogP of -4.96, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 5-methyl-2,4-dioxopyrimidine-1-carboxylate is sourced from PubChem (CID 139627493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).