C5H5N3O5 — CID 142715788
(5-methyl-2,4-dioxopyrimidin-1-yl) nitrate (PubChem CID 142715788) has the molecular formula C5H5N3O5 and a molecular weight of 187.11 g/mol. Its IUPAC name is (5-methyl-2,4-dioxopyrimidin-1-yl) nitrate.
| Compound Name | (5-methyl-2,4-dioxopyrimidin-1-yl) nitrate |
|---|---|
| PubChem CID | 142715788 |
| Molecular Formula | C5H5N3O5 |
| Molecular Weight | 187.11 g/mol |
| Exact Mass | 187.02 |
| IUPAC Name | (5-methyl-2,4-dioxopyrimidin-1-yl) nitrate |
| SMILES | Cc1cn(O[N+](=O)[O-])c(=O)[nH]c1=O |
| InChI | InChI=1S/C5H5N3O5/c1-3-2-7(13-8(11)12)5(10)6-4(3)9/h2H,1H3,(H,6,9,10) |
| InChIKey | DDWRSVJQMIHTIU-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 107.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.11 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|