C8H12N3O7P — CID 68859928
1-[amino(1,3-dioxolan-2-yloxy)phosphoryl]oxy-5-methylpyrimidine-2,4-dione (PubChem CID 68859928) has the molecular formula C8H12N3O7P and a molecular weight of 293.17 g/mol. Its IUPAC name is 1-[amino(1,3-dioxolan-2-yloxy)phosphoryl]oxy-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[amino(1,3-dioxolan-2-yloxy)phosphoryl]oxy-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 68859928 |
| Molecular Formula | C8H12N3O7P |
| Molecular Weight | 293.17 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 1-[amino(1,3-dioxolan-2-yloxy)phosphoryl]oxy-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn(OP(N)(=O)OC2OCCO2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C8H12N3O7P/c1-5-4-11(7(13)10-6(5)12)18-19(9,14)17-8-15-2-3-16-8/h4,8H,2-3H2,1H3,(H2,9,14)(H,10,12,13) |
| InChIKey | LYTPNCWLAVIRPN-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 134.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.17 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|