C11H18N2O3Si — CID 15405094
1-[(Z)-3-[hydroxymethyl(dimethyl)silyl]prop-2-enyl]-5-methylpyrimidine-2,4-dione (PubChem CID 15405094) has the molecular formula C11H18N2O3Si and a molecular weight of 254.36 g/mol. Its IUPAC name is 1-[(Z)-3-[hydroxymethyl(dimethyl)silyl]prop-2-enyl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(Z)-3-[hydroxymethyl(dimethyl)silyl]prop-2-enyl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 15405094 |
| Molecular Formula | C11H18N2O3Si |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 1-[(Z)-3-[hydroxymethyl(dimethyl)silyl]prop-2-enyl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn(C/C=C\[Si](C)(C)CO)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H18N2O3Si/c1-9-7-13(11(16)12-10(9)15)5-4-6-17(2,3)8-14/h4,6-7,14H,5,8H2,1-3H3,(H,12,15,16)/b6-4- |
| InChIKey | GOHIJACNOSEWPV-XQRVVYSFSA-N |
| XLogP | 0.18 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|