C19H31N2O8P — CID 54387676
1-[4-diethoxyphosphoryl-2-(oxan-2-yloxymethyl)but-3-enoxy]-5-methylpyrimidine-2,4-dione (PubChem CID 54387676) has the molecular formula C19H31N2O8P and a molecular weight of 446.44 g/mol. Its IUPAC name is 1-[4-diethoxyphosphoryl-2-(oxan-2-yloxymethyl)but-3-enoxy]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[4-diethoxyphosphoryl-2-(oxan-2-yloxymethyl)but-3-enoxy]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 54387676 |
| Molecular Formula | C19H31N2O8P |
| Molecular Weight | 446.44 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 1-[4-diethoxyphosphoryl-2-(oxan-2-yloxymethyl)but-3-enoxy]-5-methylpyrimidine-2,4-dione |
| SMILES | CCOP(=O)(C=CC(COC1CCCCO1)COn1cc(C)c(=O)[nH]c1=O)OCC |
| InChI | InChI=1S/C19H31N2O8P/c1-4-28-30(24,29-5-2)11-9-16(13-26-17-8-6-7-10-25-17)14-27-21-12-15(3)18(22)20-19(21)23/h9,11-12,16-17H,4-8,10,13-14H2,1-3H3,(H,20,22,23) |
| InChIKey | VEKABBGBRMBSDM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 118.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.44 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|