C15H23N2O7P — CID 90371282
1-[(2R,3S,5S)-5-[(E)-2-diethoxyphosphorylethenyl]-3-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 90371282) has the molecular formula C15H23N2O7P and a molecular weight of 374.33 g/mol. Its IUPAC name is 1-[(2R,3S,5S)-5-[(E)-2-diethoxyphosphorylethenyl]-3-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3S,5S)-5-[(E)-2-diethoxyphosphorylethenyl]-3-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 90371282 |
| Molecular Formula | C15H23N2O7P |
| Molecular Weight | 374.33 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 1-[(2R,3S,5S)-5-[(E)-2-diethoxyphosphorylethenyl]-3-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | CCOP(=O)(/C=C/[C@@H]1C[C@H](O)[C@H](n2cc(C)c(=O)[nH]c2=O)O1)OCC |
| InChI | InChI=1S/C15H23N2O7P/c1-4-22-25(21,23-5-2)7-6-11-8-12(18)14(24-11)17-9-10(3)13(19)16-15(17)20/h6-7,9,11-12,14,18H,4-5,8H2,1-3H3,(H,16,19,20)/b7-6+/t11-,12+,14-/m1/s1 |
| InChIKey | UXRNNKGPSXBNNC-MEERCUOESA-N |
| XLogP | 1.27 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.33 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|