C26H30N5O8P — CID 173363385
2-[9-[(2R)-4-diethoxyphosphoryl-2-[(2S)-oxan-2-yl]oxybut-3-enoxy]purin-6-yl]isoindole-1,3-dione (PubChem CID 173363385) has the molecular formula C26H30N5O8P and a molecular weight of 571.53 g/mol. Its IUPAC name is 2-[9-[(2R)-4-diethoxyphosphoryl-2-[(2S)-oxan-2-yl]oxybut-3-enoxy]purin-6-yl]isoindole-1,3-dione.
| Compound Name | 2-[9-[(2R)-4-diethoxyphosphoryl-2-[(2S)-oxan-2-yl]oxybut-3-enoxy]purin-6-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 173363385 |
| Molecular Formula | C26H30N5O8P |
| Molecular Weight | 571.53 g/mol |
| Exact Mass | 571.18 |
| IUPAC Name | 2-[9-[(2R)-4-diethoxyphosphoryl-2-[(2S)-oxan-2-yl]oxybut-3-enoxy]purin-6-yl]isoindole-1,3-dione |
| SMILES | CCOP(=O)(C=C[C@H](COn1cnc2c(N3C(=O)c4ccccc4C3=O)ncnc21)O[C@H]1CCCCO1)OCC |
| InChI | InChI=1S/C26H30N5O8P/c1-3-37-40(34,38-4-2)14-12-18(39-21-11-7-8-13-35-21)15-36-30-17-29-22-23(30)27-16-28-24(22)31-25(32)19-9-5-6-10-20(19)26(31)33/h5-6,9-10,12,14,16-18,21H,3-4,7-8,11,13,15H2,1-2H3/t18-,21+/m1/s1 |
| InChIKey | PJHDHZLXJNZPBA-NQIIRXRSSA-N |
| XLogP | 3.75 |
| TPSA | 144.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.53 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|