C14H20BrN5O3 — CID 14935378
9-[1-bromo-2-methoxy-3-(oxan-2-yloxy)propan-2-yl]purin-6-amine (PubChem CID 14935378) has the molecular formula C14H20BrN5O3 and a molecular weight of 386.25 g/mol. Its IUPAC name is 9-[1-bromo-2-methoxy-3-(oxan-2-yloxy)propan-2-yl]purin-6-amine.
| Compound Name | 9-[1-bromo-2-methoxy-3-(oxan-2-yloxy)propan-2-yl]purin-6-amine |
|---|---|
| PubChem CID | 14935378 |
| Molecular Formula | C14H20BrN5O3 |
| Molecular Weight | 386.25 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 9-[1-bromo-2-methoxy-3-(oxan-2-yloxy)propan-2-yl]purin-6-amine |
| SMILES | COC(CBr)(COC1CCCCO1)n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C14H20BrN5O3/c1-21-14(6-15,7-23-10-4-2-3-5-22-10)20-9-19-11-12(16)17-8-18-13(11)20/h8-10H,2-7H2,1H3,(H2,16,17,18) |
| InChIKey | BTEGMAFNNWDRKE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|