C16H25N5O10P2 — CID 170551005
[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[[hydroxy(oxan-2-yloxy)phosphoryl]methyl]phosphinic acid (PubChem CID 170551005) has the molecular formula C16H25N5O10P2 and a molecular weight of 509.35 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[[hydroxy(oxan-2-yloxy)phosphoryl]methyl]phosphinic acid.
| Compound Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[[hydroxy(oxan-2-yloxy)phosphoryl]methyl]phosphinic acid |
|---|---|
| PubChem CID | 170551005 |
| Molecular Formula | C16H25N5O10P2 |
| Molecular Weight | 509.35 g/mol |
| Exact Mass | 509.11 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[[hydroxy(oxan-2-yloxy)phosphoryl]methyl]phosphinic acid |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)CP(=O)(O)OC2CCCCO2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H25N5O10P2/c17-14-11-15(19-6-18-14)21(7-20-11)16-13(23)12(22)9(30-16)5-29-32(24,25)8-33(26,27)31-10-3-1-2-4-28-10/h6-7,9-10,12-13,16,22-23H,1-5,8H2,(H,24,25)(H,26,27)(H2,17,18,19)/t9-,10?,12-,13-,16-/m1/s1 |
| InChIKey | UUALSOWNMDYHFK-INOFZQSRSA-N |
| XLogP | -0.08 |
| TPSA | 221.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.35 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|