C32H28ClN5O3 — CID 147690121
2-[(4-chloro-6-methylcyclohexa-1,3-dien-1-yl)-[4-[9-(oxan-2-yl)purin-6-yl]phenyl]methyl]isoindole-1,3-dione (PubChem CID 147690121) has the molecular formula C32H28ClN5O3 and a molecular weight of 566.06 g/mol. Its IUPAC name is 2-[(4-chloro-6-methylcyclohexa-1,3-dien-1-yl)-[4-[9-(oxan-2-yl)purin-6-yl]phenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[(4-chloro-6-methylcyclohexa-1,3-dien-1-yl)-[4-[9-(oxan-2-yl)purin-6-yl]phenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 147690121 |
| Molecular Formula | C32H28ClN5O3 |
| Molecular Weight | 566.06 g/mol |
| Exact Mass | 565.19 |
| IUPAC Name | 2-[(4-chloro-6-methylcyclohexa-1,3-dien-1-yl)-[4-[9-(oxan-2-yl)purin-6-yl]phenyl]methyl]isoindole-1,3-dione |
| SMILES | CC1CC(Cl)=CC=C1C(c1ccc(-c2ncnc3c2ncn3C2CCCCO2)cc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C32H28ClN5O3/c1-19-16-22(33)13-14-23(19)29(38-31(39)24-6-2-3-7-25(24)32(38)40)21-11-9-20(10-12-21)27-28-30(35-17-34-27)37(18-36-28)26-8-4-5-15-41-26/h2-3,6-7,9-14,17-19,26,29H,4-5,8,15-16H2,1H3 |
| InChIKey | GQUUOEQSSNRVBW-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 90.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.06 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|