C35H37N9O3 — CID 157497420
N-methyl-1-[4-[9-(oxan-2-yl)purin-6-yl]phenyl]methanamine;4-[9-(oxan-2-yl)purin-6-yl]benzaldehyde (PubChem CID 157497420) has the molecular formula C35H37N9O3 and a molecular weight of 631.74 g/mol. Its IUPAC name is N-methyl-1-[4-[9-(oxan-2-yl)purin-6-yl]phenyl]methanamine;4-[9-(oxan-2-yl)purin-6-yl]benzaldehyde.
| Compound Name | N-methyl-1-[4-[9-(oxan-2-yl)purin-6-yl]phenyl]methanamine;4-[9-(oxan-2-yl)purin-6-yl]benzaldehyde |
|---|---|
| PubChem CID | 157497420 |
| Molecular Formula | C35H37N9O3 |
| Molecular Weight | 631.74 g/mol |
| Exact Mass | 631.30 |
| IUPAC Name | N-methyl-1-[4-[9-(oxan-2-yl)purin-6-yl]phenyl]methanamine;4-[9-(oxan-2-yl)purin-6-yl]benzaldehyde |
| SMILES | CNCc1ccc(-c2ncnc3c2ncn3C2CCCCO2)cc1.O=Cc1ccc(-c2ncnc3c2ncn3C2CCCCO2)cc1 |
| InChI | InChI=1S/C18H21N5O.C17H16N4O2/c1-19-10-13-5-7-14(8-6-13)16-17-18(21-11-20-16)23(12-22-17)15-4-2-3-9-24-15;22-9-12-4-6-13(7-5-12)15-16-17(19-10-18-15)21(11-20-16)14-3-1-2-8-23-14/h5-8,11-12,15,19H,2-4,9-10H2,1H3;4-7,9-11,14H,1-3,8H2 |
| InChIKey | BXZNVCIDWNBRFH-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 134.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.74 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|