C16H16N4OS — CID 10828923
9-(oxan-2-yl)-6-[(E)-2-thiophen-2-ylethenyl]purine (PubChem CID 10828923) has the molecular formula C16H16N4OS and a molecular weight of 312.40 g/mol. Its IUPAC name is 9-(oxan-2-yl)-6-[(E)-2-thiophen-2-ylethenyl]purine.
| Compound Name | 9-(oxan-2-yl)-6-[(E)-2-thiophen-2-ylethenyl]purine |
|---|---|
| PubChem CID | 10828923 |
| Molecular Formula | C16H16N4OS |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 9-(oxan-2-yl)-6-[(E)-2-thiophen-2-ylethenyl]purine |
| SMILES | C(=C/c1ncnc2c1ncn2C1CCCCO1)\c1cccs1 |
| InChI | InChI=1S/C16H16N4OS/c1-2-8-21-14(5-1)20-11-19-15-13(17-10-18-16(15)20)7-6-12-4-3-9-22-12/h3-4,6-7,9-11,14H,1-2,5,8H2/b7-6+ |
| InChIKey | CVQHZJTXLSJNDB-VOTSOKGWSA-N |
| XLogP | 3.76 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |