C17H21N5O — CID 169200073
(3Z)-N-methyl-3-[9-(oxan-2-yl)purin-6-yl]hexa-3,5-dien-2-imine (PubChem CID 169200073) has the molecular formula C17H21N5O and a molecular weight of 311.39 g/mol. Its IUPAC name is (3Z)-N-methyl-3-[9-(oxan-2-yl)purin-6-yl]hexa-3,5-dien-2-imine.
| Compound Name | (3Z)-N-methyl-3-[9-(oxan-2-yl)purin-6-yl]hexa-3,5-dien-2-imine |
|---|---|
| PubChem CID | 169200073 |
| Molecular Formula | C17H21N5O |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | (3Z)-N-methyl-3-[9-(oxan-2-yl)purin-6-yl]hexa-3,5-dien-2-imine |
| SMILES | C=C/C=C(C(\C)=N\C)/c1ncnc2c1ncn2C1CCCCO1 |
| InChI | InChI=1S/C17H21N5O/c1-4-7-13(12(2)18-3)15-16-17(20-10-19-15)22(11-21-16)14-8-5-6-9-23-14/h4,7,10-11,14H,1,5-6,8-9H2,2-3H3/b13-7+,18-12+ |
| InChIKey | NOYZYHOASAEGOJ-WQIABQQASA-N |
| XLogP | 3.19 |
| TPSA | 65.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|