C17H22N4O3 — CID 57328184
6-(3,3-diethoxyprop-1-ynyl)-9-(oxan-2-yl)purine (PubChem CID 57328184) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is 6-(3,3-diethoxyprop-1-ynyl)-9-(oxan-2-yl)purine.
| Compound Name | 6-(3,3-diethoxyprop-1-ynyl)-9-(oxan-2-yl)purine |
|---|---|
| PubChem CID | 57328184 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 6-(3,3-diethoxyprop-1-ynyl)-9-(oxan-2-yl)purine |
| SMILES | CCOC(C#Cc1ncnc2c1ncn2C1CCCCO1)OCC |
| InChI | InChI=1S/C17H22N4O3/c1-3-22-15(23-4-2)9-8-13-16-17(19-11-18-13)21(12-20-16)14-7-5-6-10-24-14/h11-12,14-15H,3-7,10H2,1-2H3 |
| InChIKey | RMPGLUFJEDDKMP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 71.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|