C27H27ClN6O2 — CID 163791401
8-chloro-3-[(1S)-1-[[9-(oxan-2-yl)purin-6-yl]amino]ethyl]-2-phenyl-8,8a-dihydroisoquinolin-1-one (PubChem CID 163791401) has the molecular formula C27H27ClN6O2 and a molecular weight of 503.01 g/mol. Its IUPAC name is 8-chloro-3-[(1S)-1-[[9-(oxan-2-yl)purin-6-yl]amino]ethyl]-2-phenyl-8,8a-dihydroisoquinolin-1-one.
| Compound Name | 8-chloro-3-[(1S)-1-[[9-(oxan-2-yl)purin-6-yl]amino]ethyl]-2-phenyl-8,8a-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 163791401 |
| Molecular Formula | C27H27ClN6O2 |
| Molecular Weight | 503.01 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | 8-chloro-3-[(1S)-1-[[9-(oxan-2-yl)purin-6-yl]amino]ethyl]-2-phenyl-8,8a-dihydroisoquinolin-1-one |
| SMILES | C[C@H](Nc1ncnc2c1ncn2C1CCCCO1)C1=CC2=CC=CC(Cl)C2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C27H27ClN6O2/c1-17(32-25-24-26(30-15-29-25)33(16-31-24)22-12-5-6-13-36-22)21-14-18-8-7-11-20(28)23(18)27(35)34(21)19-9-3-2-4-10-19/h2-4,7-11,14-17,20,22-23H,5-6,12-13H2,1H3,(H,29,30,32)/t17-,20?,22?,23?/m0/s1 |
| InChIKey | MXCGCTIVLBRWDJ-MUJCKVTBSA-N |
| XLogP | 4.98 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.01 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|