C23H23ClN6O2 — CID 126756124
2-amino-4-[1-(8-chloro-1-oxo-2-phenyl-8,8a-dihydroisoquinolin-3-yl)ethylamino]-N-methylpyrimidine-5-carboxamide (PubChem CID 126756124) has the molecular formula C23H23ClN6O2 and a molecular weight of 450.93 g/mol. Its IUPAC name is 2-amino-4-[1-(8-chloro-1-oxo-2-phenyl-8,8a-dihydroisoquinolin-3-yl)ethylamino]-N-methylpyrimidine-5-carboxamide.
| Compound Name | 2-amino-4-[1-(8-chloro-1-oxo-2-phenyl-8,8a-dihydroisoquinolin-3-yl)ethylamino]-N-methylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 126756124 |
| Molecular Formula | C23H23ClN6O2 |
| Molecular Weight | 450.93 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 2-amino-4-[1-(8-chloro-1-oxo-2-phenyl-8,8a-dihydroisoquinolin-3-yl)ethylamino]-N-methylpyrimidine-5-carboxamide |
| SMILES | CNC(=O)c1cnc(N)nc1NC(C)C1=CC2=CC=CC(Cl)C2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C23H23ClN6O2/c1-13(28-20-16(21(31)26-2)12-27-23(25)29-20)18-11-14-7-6-10-17(24)19(14)22(32)30(18)15-8-4-3-5-9-15/h3-13,17,19H,1-2H3,(H,26,31)(H3,25,27,28,29) |
| InChIKey | PBXQGAUVKSKDOZ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 113.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.93 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|