C25H23BrFN7O — CID 123275466
N-[1-(7-bromo-6-fluoro-1-phenylbenzimidazol-2-yl)ethyl]-9-[(2S)-oxan-2-yl]purin-6-amine (PubChem CID 123275466) has the molecular formula C25H23BrFN7O and a molecular weight of 536.41 g/mol. Its IUPAC name is N-[1-(7-bromo-6-fluoro-1-phenylbenzimidazol-2-yl)ethyl]-9-[(2S)-oxan-2-yl]purin-6-amine.
| Compound Name | N-[1-(7-bromo-6-fluoro-1-phenylbenzimidazol-2-yl)ethyl]-9-[(2S)-oxan-2-yl]purin-6-amine |
|---|---|
| PubChem CID | 123275466 |
| Molecular Formula | C25H23BrFN7O |
| Molecular Weight | 536.41 g/mol |
| Exact Mass | 535.11 |
| IUPAC Name | N-[1-(7-bromo-6-fluoro-1-phenylbenzimidazol-2-yl)ethyl]-9-[(2S)-oxan-2-yl]purin-6-amine |
| SMILES | CC(Nc1ncnc2c1ncn2[C@@H]1CCCCO1)c1nc2ccc(F)c(Br)c2n1-c1ccccc1 |
| InChI | InChI=1S/C25H23BrFN7O/c1-15(31-23-21-25(29-13-28-23)33(14-30-21)19-9-5-6-12-35-19)24-32-18-11-10-17(27)20(26)22(18)34(24)16-7-3-2-4-8-16/h2-4,7-8,10-11,13-15,19H,5-6,9,12H2,1H3,(H,28,29,31)/t15?,19-/m0/s1 |
| InChIKey | UHTRHXOMXNTJPZ-FUBQLUNQSA-N |
| XLogP | 5.94 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.41 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |