C22H24FN7O2 — CID 123731510
N-[2-[(11S)-7-fluoro-11-methyl-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-2-yl]ethyl]-9-[(2S)-oxan-2-yl]purin-6-amine (PubChem CID 123731510) has the molecular formula C22H24FN7O2 and a molecular weight of 437.48 g/mol. Its IUPAC name is N-[2-[(11S)-7-fluoro-11-methyl-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-2-yl]ethyl]-9-[(2S)-oxan-2-yl]purin-6-amine.
| Compound Name | N-[2-[(11S)-7-fluoro-11-methyl-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-2-yl]ethyl]-9-[(2S)-oxan-2-yl]purin-6-amine |
|---|---|
| PubChem CID | 123731510 |
| Molecular Formula | C22H24FN7O2 |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | N-[2-[(11S)-7-fluoro-11-methyl-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-2-yl]ethyl]-9-[(2S)-oxan-2-yl]purin-6-amine |
| SMILES | C[C@H]1COc2c(F)ccc3nc(CCNc4ncnc5c4ncn5[C@@H]4CCCCO4)n1c23 |
| InChI | InChI=1S/C22H24FN7O2/c1-13-10-32-20-14(23)5-6-15-19(20)30(13)16(28-15)7-8-24-21-18-22(26-11-25-21)29(12-27-18)17-4-2-3-9-31-17/h5-6,11-13,17H,2-4,7-10H2,1H3,(H,24,25,26)/t13-,17-/m0/s1 |
| InChIKey | GBNMUKGJNNNFIB-GUYCJALGSA-N |
| XLogP | 3.62 |
| TPSA | 91.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |