C28H28FN7O — CID 77456404
N-[1-(7-cyclopropyl-6-fluoro-1-phenylbenzimidazol-2-yl)ethyl]-9-(oxan-2-yl)purin-6-amine (PubChem CID 77456404) has the molecular formula C28H28FN7O and a molecular weight of 497.58 g/mol. Its IUPAC name is N-[1-(7-cyclopropyl-6-fluoro-1-phenylbenzimidazol-2-yl)ethyl]-9-(oxan-2-yl)purin-6-amine.
| Compound Name | N-[1-(7-cyclopropyl-6-fluoro-1-phenylbenzimidazol-2-yl)ethyl]-9-(oxan-2-yl)purin-6-amine |
|---|---|
| PubChem CID | 77456404 |
| Molecular Formula | C28H28FN7O |
| Molecular Weight | 497.58 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | N-[1-(7-cyclopropyl-6-fluoro-1-phenylbenzimidazol-2-yl)ethyl]-9-(oxan-2-yl)purin-6-amine |
| SMILES | CC(Nc1ncnc2c1ncn2C1CCCCO1)c1nc2ccc(F)c(C3CC3)c2n1-c1ccccc1 |
| InChI | InChI=1S/C28H28FN7O/c1-17(33-26-24-28(31-15-30-26)35(16-32-24)22-9-5-6-14-37-22)27-34-21-13-12-20(29)23(18-10-11-18)25(21)36(27)19-7-3-2-4-8-19/h2-4,7-8,12-13,15-18,22H,5-6,9-11,14H2,1H3,(H,30,31,33) |
| InChIKey | XSARGWXIOJIFPX-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.58 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |